C38H54N6O4SSi2 — CID 67295062
3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-methylsulfanyl-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylic acid (PubChem CID 67295062) has the molecular formula C38H54N6O4SSi2 and a molecular weight of 747.13 g/mol. Its IUPAC name is 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-methylsulfanyl-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylic acid.
| Compound Name | 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-methylsulfanyl-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylic acid |
|---|---|
| PubChem CID | 67295062 |
| Molecular Formula | C38H54N6O4SSi2 |
| Molecular Weight | 747.13 g/mol |
| Exact Mass | 746.35 |
| IUPAC Name | 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-methylsulfanyl-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylic acid |
| SMILES | CSc1c(C2CC3CCC(C2)N3C(=O)O)nc2c(-c3ccc(-c4ccccc4)nc3)cnn2c1N(COCC[Si](C)(C)C)COCC[Si](C)(C)C |
| InChI | InChI=1S/C38H54N6O4SSi2/c1-49-35-34(29-21-30-14-15-31(22-29)43(30)38(45)46)41-36-32(28-13-16-33(39-23-28)27-11-9-8-10-12-27)24-40-44(36)37(35)42(25-47-17-19-50(2,3)4)26-48-18-20-51(5,6)7/h8-13,16,23-24,29-31H,14-15,17-22,25-26H2,1-7H3,(H,45,46) |
| InChIKey | XWWRUPVDDQDTKQ-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.13 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|