About iron;4-(2-methylcyclopentyl)oxypyrrolidin-3-ol
iron;4-(2-methylcyclopentyl)oxypyrrolidin-3-ol (PubChem CID 67297423) has the molecular formula C10H19FeNO2
and a molecular weight of 241.11 g/mol. Its IUPAC name is iron;4-(2-methylcyclopentyl)oxypyrrolidin-3-ol.
Molecular Properties
| Compound Name | iron;4-(2-methylcyclopentyl)oxypyrrolidin-3-ol |
| PubChem CID | 67297423 |
| Molecular Formula | C10H19FeNO2 |
| Molecular Weight | 241.11 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | iron;4-(2-methylcyclopentyl)oxypyrrolidin-3-ol |
| SMILES | CC1CCCC1OC1CNCC1O.[Fe] |
| InChI | InChI=1S/C10H19NO2.Fe/c1-7-3-2-4-9(7)13-10-6-11-5-8(10)12;/h7-12H,2-6H2,1H3; |
| InChIKey | ZTNRPFQVACJBST-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.11 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze iron;4-(2-methylcyclopentyl)oxypyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iron;4-(2-methylcyclopentyl)oxypyrrolidin-3-ol?
The IUPAC name of iron;4-(2-methylcyclopentyl)oxypyrrolidin-3-ol (CID 67297423) is iron;4-(2-methylcyclopentyl)oxypyrrolidin-3-ol.
What is the SMILES notation for iron;4-(2-methylcyclopentyl)oxypyrrolidin-3-ol?
The canonical SMILES for iron;4-(2-methylcyclopentyl)oxypyrrolidin-3-ol is CC1CCCC1OC1CNCC1O.[Fe].
What is the InChIKey of iron;4-(2-methylcyclopentyl)oxypyrrolidin-3-ol?
The InChIKey is ZTNRPFQVACJBST-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2.Fe/c1-7-3-2-4-9(7)13-10-6-11-5-8(10)12;/h7-12H,2-6H2,1H3;.
What are the key properties of iron;4-(2-methylcyclopentyl)oxypyrrolidin-3-ol?
iron;4-(2-methylcyclopentyl)oxypyrrolidin-3-ol has a molecular weight of 241.11 g/mol, XLogP of 0.52, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for iron;4-(2-methylcyclopentyl)oxypyrrolidin-3-ol is sourced from PubChem (CID 67297423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).