C35H31N3O6 — CID 6729782
(3R,3'R,4'S,6'R,8'S,8'aS)-6'-[4-(2-hydroxyethoxy)phenyl]-1',2-dioxo-3',4'-diphenylspiro[1H-indole-3,7'-4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine]-8'-carboxamide (PubChem CID 6729782) has the molecular formula C35H31N3O6 and a molecular weight of 589.65 g/mol. Its IUPAC name is (3R,3'R,4'S,6'R,8'S,8'aS)-6'-[4-(2-hydroxyethoxy)phenyl]-1',2-dioxo-3',4'-diphenylspiro[1H-indole-3,7'-4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine]-8'-carboxamide.
| Compound Name | (3R,3'R,4'S,6'R,8'S,8'aS)-6'-[4-(2-hydroxyethoxy)phenyl]-1',2-dioxo-3',4'-diphenylspiro[1H-indole-3,7'-4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine]-8'-carboxamide |
|---|---|
| PubChem CID | 6729782 |
| Molecular Formula | C35H31N3O6 |
| Molecular Weight | 589.65 g/mol |
| Exact Mass | 589.22 |
| IUPAC Name | (3R,3'R,4'S,6'R,8'S,8'aS)-6'-[4-(2-hydroxyethoxy)phenyl]-1',2-dioxo-3',4'-diphenylspiro[1H-indole-3,7'-4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine]-8'-carboxamide |
| SMILES | NC(=O)[C@@H]1[C@H]2C(=O)O[C@H](c3ccccc3)[C@H](c3ccccc3)N2[C@H](c2ccc(OCCO)cc2)[C@@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C35H31N3O6/c36-32(40)27-29-33(41)44-30(22-11-5-2-6-12-22)28(21-9-3-1-4-10-21)38(29)31(23-15-17-24(18-16-23)43-20-19-39)35(27)25-13-7-8-14-26(25)37-34(35)42/h1-18,27-31,39H,19-20H2,(H2,36,40)(H,37,42)/t27-,28-,29-,30+,31+,35-/m0/s1 |
| InChIKey | KFKWQMQNIILYJL-HKFRCHOZSA-N |
| XLogP | 3.81 |
| TPSA | 131.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.65 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |