C40H56N4 — CID 67298019
4-[1-(4-amino-3-tert-butylphenyl)ethyl]-2-tert-butylaniline;4-[1-(4-amino-3,5-dimethylphenyl)ethyl]-2,6-dimethylaniline (PubChem CID 67298019) has the molecular formula C40H56N4 and a molecular weight of 592.92 g/mol. Its IUPAC name is 4-[1-(4-amino-3-tert-butylphenyl)ethyl]-2-tert-butylaniline;4-[1-(4-amino-3,5-dimethylphenyl)ethyl]-2,6-dimethylaniline.
| Compound Name | 4-[1-(4-amino-3-tert-butylphenyl)ethyl]-2-tert-butylaniline;4-[1-(4-amino-3,5-dimethylphenyl)ethyl]-2,6-dimethylaniline |
|---|---|
| PubChem CID | 67298019 |
| Molecular Formula | C40H56N4 |
| Molecular Weight | 592.92 g/mol |
| Exact Mass | 592.45 |
| IUPAC Name | 4-[1-(4-amino-3-tert-butylphenyl)ethyl]-2-tert-butylaniline;4-[1-(4-amino-3,5-dimethylphenyl)ethyl]-2,6-dimethylaniline |
| SMILES | CC(c1ccc(N)c(C(C)(C)C)c1)c1ccc(N)c(C(C)(C)C)c1.Cc1cc(C(C)c2cc(C)c(N)c(C)c2)cc(C)c1N |
| InChI | InChI=1S/C22H32N2.C18H24N2/c1-14(15-8-10-19(23)17(12-15)21(2,3)4)16-9-11-20(24)18(13-16)22(5,6)7;1-10-6-15(7-11(2)17(10)19)14(5)16-8-12(3)18(20)13(4)9-16/h8-14H,23-24H2,1-7H3;6-9,14H,19-20H2,1-5H3 |
| InChIKey | NNQHKKUXFQBECD-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.92 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|