C28H39BrN6O3Si — CID 67298770
tert-butyl N-[1-[12-bromo-4-cyano-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-13-yl]ethyl]-N-[(3S)-pyrrolidin-3-yl]carbamate (PubChem CID 67298770) has the molecular formula C28H39BrN6O3Si and a molecular weight of 615.65 g/mol. Its IUPAC name is tert-butyl N-[1-[12-bromo-4-cyano-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-13-yl]ethyl]-N-[(3S)-pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[12-bromo-4-cyano-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-13-yl]ethyl]-N-[(3S)-pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 67298770 |
| Molecular Formula | C28H39BrN6O3Si |
| Molecular Weight | 615.65 g/mol |
| Exact Mass | 614.20 |
| IUPAC Name | tert-butyl N-[1-[12-bromo-4-cyano-8-(2-trimethylsilylethoxymethyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-13-yl]ethyl]-N-[(3S)-pyrrolidin-3-yl]carbamate |
| SMILES | CC(c1c(Br)cnc2c1c1cc(C#N)ncc1n2COCC[Si](C)(C)C)N(C(=O)OC(C)(C)C)[C@H]1CCNC1 |
| InChI | InChI=1S/C28H39BrN6O3Si/c1-18(35(20-8-9-31-14-20)27(36)38-28(2,3)4)24-22(29)15-33-26-25(24)21-12-19(13-30)32-16-23(21)34(26)17-37-10-11-39(5,6)7/h12,15-16,18,20,31H,8-11,14,17H2,1-7H3/t18?,20-/m0/s1 |
| InChIKey | ZWAKSQHQJXCCMW-IJHRGXPZSA-N |
| XLogP | 6.19 |
| TPSA | 105.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.65 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|