C18H25ClFN3O2 — CID 67299876
8-(2-chloro-6-fluorophenoxy)-2,2-dimethyl-4-(1,2,4-triazol-1-yl)octan-3-ol (PubChem CID 67299876) has the molecular formula C18H25ClFN3O2 and a molecular weight of 369.87 g/mol. Its IUPAC name is 8-(2-chloro-6-fluorophenoxy)-2,2-dimethyl-4-(1,2,4-triazol-1-yl)octan-3-ol.
| Compound Name | 8-(2-chloro-6-fluorophenoxy)-2,2-dimethyl-4-(1,2,4-triazol-1-yl)octan-3-ol |
|---|---|
| PubChem CID | 67299876 |
| Molecular Formula | C18H25ClFN3O2 |
| Molecular Weight | 369.87 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 8-(2-chloro-6-fluorophenoxy)-2,2-dimethyl-4-(1,2,4-triazol-1-yl)octan-3-ol |
| SMILES | CC(C)(C)C(O)C(CCCCOc1c(F)cccc1Cl)n1cncn1 |
| InChI | InChI=1S/C18H25ClFN3O2/c1-18(2,3)17(24)15(23-12-21-11-22-23)9-4-5-10-25-16-13(19)7-6-8-14(16)20/h6-8,11-12,15,17,24H,4-5,9-10H2,1-3H3 |
| InChIKey | MMYDLTZATOVGRW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.87 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|