C10H12F3NO2 — CID 67300044
(2,3-dimethylphenyl)azanium;2,2,2-trifluoroacetate (PubChem CID 67300044) has the molecular formula C10H12F3NO2 and a molecular weight of 235.20 g/mol. Its IUPAC name is (2,3-dimethylphenyl)azanium;2,2,2-trifluoroacetate.
| Compound Name | (2,3-dimethylphenyl)azanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 67300044 |
| Molecular Formula | C10H12F3NO2 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | (2,3-dimethylphenyl)azanium;2,2,2-trifluoroacetate |
| SMILES | Cc1cccc([NH3+])c1C.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C8H11N.C2HF3O2/c1-6-4-3-5-8(9)7(6)2;3-2(4,5)1(6)7/h3-5H,9H2,1-2H3;(H,6,7) |
| InChIKey | CMJQUPDZWFIAJO-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |