About 2-(4-chlorophenyl)-1-cyclooctyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide
2-(4-chlorophenyl)-1-cyclooctyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide (PubChem CID 67300608) has the molecular formula C20H25BrClN3O
and a molecular weight of 438.80 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-cyclooctyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-1-cyclooctyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide |
| PubChem CID | 67300608 |
| Molecular Formula | C20H25BrClN3O |
| Molecular Weight | 438.80 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | 2-(4-chlorophenyl)-1-cyclooctyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide |
| SMILES | OC1(c2ccc(Cl)cc2)C[n+]2cccnc2N1C1CCCCCCC1.[Br-] |
| InChI | InChI=1S/C20H25ClN3O.BrH/c21-17-11-9-16(10-12-17)20(25)15-23-14-6-13-22-19(23)24(20)18-7-4-2-1-3-5-8-18;/h6,9-14,18,25H,1-5,7-8,15H2;1H/q+1;/p-1 |
| InChIKey | HRSOYCIZTDFRKB-UHFFFAOYSA-M |
| XLogP | 0.80 |
| TPSA | 40.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.80 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chlorophenyl)-1-cyclooctyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-1-cyclooctyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide?
The IUPAC name of 2-(4-chlorophenyl)-1-cyclooctyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide (CID 67300608) is 2-(4-chlorophenyl)-1-cyclooctyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide.
What is the SMILES notation for 2-(4-chlorophenyl)-1-cyclooctyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide?
The canonical SMILES for 2-(4-chlorophenyl)-1-cyclooctyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide is OC1(c2ccc(Cl)cc2)C[n+]2cccnc2N1C1CCCCCCC1.[Br-].
What is the InChIKey of 2-(4-chlorophenyl)-1-cyclooctyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide?
The InChIKey is HRSOYCIZTDFRKB-UHFFFAOYSA-M. The full InChI is InChI=1S/C20H25ClN3O.BrH/c21-17-11-9-16(10-12-17)20(25)15-23-14-6-13-22-19(23)24(20)18-7-4-2-1-3-5-8-18;/h6,9-14,18,25H,1-5,7-8,15H2;1H/q+1;/p-1.
What are the key properties of 2-(4-chlorophenyl)-1-cyclooctyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide?
2-(4-chlorophenyl)-1-cyclooctyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide has a molecular weight of 438.80 g/mol, XLogP of 0.80, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-1-cyclooctyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide is sourced from PubChem (CID 67300608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).