C16H21NO4S — CID 67300957
4-methyl-2-[(2,2,3,3-tetramethylcyclopropanecarbonyl)amino]-4,6-dihydrothieno[2,3-c]furan-3-carboxylic acid (PubChem CID 67300957) has the molecular formula C16H21NO4S and a molecular weight of 323.41 g/mol. Its IUPAC name is 4-methyl-2-[(2,2,3,3-tetramethylcyclopropanecarbonyl)amino]-4,6-dihydrothieno[2,3-c]furan-3-carboxylic acid.
| Compound Name | 4-methyl-2-[(2,2,3,3-tetramethylcyclopropanecarbonyl)amino]-4,6-dihydrothieno[2,3-c]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 67300957 |
| Molecular Formula | C16H21NO4S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 4-methyl-2-[(2,2,3,3-tetramethylcyclopropanecarbonyl)amino]-4,6-dihydrothieno[2,3-c]furan-3-carboxylic acid |
| SMILES | CC1OCc2sc(NC(=O)C3C(C)(C)C3(C)C)c(C(=O)O)c21 |
| InChI | InChI=1S/C16H21NO4S/c1-7-9-8(6-21-7)22-13(10(9)14(19)20)17-12(18)11-15(2,3)16(11,4)5/h7,11H,6H2,1-5H3,(H,17,18)(H,19,20) |
| InChIKey | DVVYIBADIVQQOR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |