About 2-(butan-2-ylamino)acetic acid;2H-phthalazin-1-one
2-(butan-2-ylamino)acetic acid;2H-phthalazin-1-one (PubChem CID 67301026) has the molecular formula C14H19N3O3
and a molecular weight of 277.32 g/mol. Its IUPAC name is 2-(butan-2-ylamino)acetic acid;2H-phthalazin-1-one.
Molecular Properties
| Compound Name | 2-(butan-2-ylamino)acetic acid;2H-phthalazin-1-one |
| PubChem CID | 67301026 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 2-(butan-2-ylamino)acetic acid;2H-phthalazin-1-one |
| SMILES | CCC(C)NCC(=O)O.O=c1[nH]ncc2ccccc12 |
| InChI | InChI=1S/C8H6N2O.C6H13NO2/c11-8-7-4-2-1-3-6(7)5-9-10-8;1-3-5(2)7-4-6(8)9/h1-5H,(H,10,11);5,7H,3-4H2,1-2H3,(H,8,9) |
| InChIKey | JLIJXZZVJUQVPY-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(butan-2-ylamino)acetic acid;2H-phthalazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(butan-2-ylamino)acetic acid;2H-phthalazin-1-one?
The IUPAC name of 2-(butan-2-ylamino)acetic acid;2H-phthalazin-1-one (CID 67301026) is 2-(butan-2-ylamino)acetic acid;2H-phthalazin-1-one.
What is the SMILES notation for 2-(butan-2-ylamino)acetic acid;2H-phthalazin-1-one?
The canonical SMILES for 2-(butan-2-ylamino)acetic acid;2H-phthalazin-1-one is CCC(C)NCC(=O)O.O=c1[nH]ncc2ccccc12.
What is the InChIKey of 2-(butan-2-ylamino)acetic acid;2H-phthalazin-1-one?
The InChIKey is JLIJXZZVJUQVPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O.C6H13NO2/c11-8-7-4-2-1-3-6(7)5-9-10-8;1-3-5(2)7-4-6(8)9/h1-5H,(H,10,11);5,7H,3-4H2,1-2H3,(H,8,9).
What are the key properties of 2-(butan-2-ylamino)acetic acid;2H-phthalazin-1-one?
2-(butan-2-ylamino)acetic acid;2H-phthalazin-1-one has a molecular weight of 277.32 g/mol, XLogP of 1.38, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(butan-2-ylamino)acetic acid;2H-phthalazin-1-one is sourced from PubChem (CID 67301026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).