C19H31N3O4 — CID 67301078
[(3S)-3-cyano-2-(cyclohexylmethyl)-4-methyl-1-morpholin-4-yl-1-oxopentan-3-yl] carbamate (PubChem CID 67301078) has the molecular formula C19H31N3O4 and a molecular weight of 365.47 g/mol. Its IUPAC name is [(3S)-3-cyano-2-(cyclohexylmethyl)-4-methyl-1-morpholin-4-yl-1-oxopentan-3-yl] carbamate.
| Compound Name | [(3S)-3-cyano-2-(cyclohexylmethyl)-4-methyl-1-morpholin-4-yl-1-oxopentan-3-yl] carbamate |
|---|---|
| PubChem CID | 67301078 |
| Molecular Formula | C19H31N3O4 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.23 |
| IUPAC Name | [(3S)-3-cyano-2-(cyclohexylmethyl)-4-methyl-1-morpholin-4-yl-1-oxopentan-3-yl] carbamate |
| SMILES | CC(C)[C@](C#N)(OC(N)=O)C(CC1CCCCC1)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C19H31N3O4/c1-14(2)19(13-20,26-18(21)24)16(12-15-6-4-3-5-7-15)17(23)22-8-10-25-11-9-22/h14-16H,3-12H2,1-2H3,(H2,21,24)/t16?,19-/m0/s1 |
| InChIKey | DGXYKTQLFRCGAG-CVMIBEPCSA-N |
| XLogP | 2.45 |
| TPSA | 105.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |