About 1-hydroxypyridin-2-one;iron
1-hydroxypyridin-2-one;iron (PubChem CID 67301496) has the molecular formula C5H5FeNO2
and a molecular weight of 166.94 g/mol. Its IUPAC name is 1-hydroxypyridin-2-one;iron.
Molecular Properties
| Compound Name | 1-hydroxypyridin-2-one;iron |
| PubChem CID | 67301496 |
| Molecular Formula | C5H5FeNO2 |
| Molecular Weight | 166.94 g/mol |
| Exact Mass | 166.97 |
| IUPAC Name | 1-hydroxypyridin-2-one;iron |
| SMILES | O=c1ccccn1O.[Fe] |
| InChI | InChI=1S/C5H5NO2.Fe/c7-5-3-1-2-4-6(5)8;/h1-4,8H; |
| InChIKey | URXSIKIOYXZEDM-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.94 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxypyridin-2-one;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxypyridin-2-one;iron?
The IUPAC name of 1-hydroxypyridin-2-one;iron (CID 67301496) is 1-hydroxypyridin-2-one;iron.
What is the SMILES notation for 1-hydroxypyridin-2-one;iron?
The canonical SMILES for 1-hydroxypyridin-2-one;iron is O=c1ccccn1O.[Fe].
What is the InChIKey of 1-hydroxypyridin-2-one;iron?
The InChIKey is URXSIKIOYXZEDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO2.Fe/c7-5-3-1-2-4-6(5)8;/h1-4,8H;.
What are the key properties of 1-hydroxypyridin-2-one;iron?
1-hydroxypyridin-2-one;iron has a molecular weight of 166.94 g/mol, XLogP of 0.08, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxypyridin-2-one;iron is sourced from PubChem (CID 67301496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).