C11H13N3 — CID 67302414
1,2,3,4,4a,5-hexahydropyrido[2,3-f]quinoxaline (PubChem CID 67302414) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is 1,2,3,4,4a,5-hexahydropyrido[2,3-f]quinoxaline.
| Compound Name | 1,2,3,4,4a,5-hexahydropyrido[2,3-f]quinoxaline |
|---|---|
| PubChem CID | 67302414 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 1,2,3,4,4a,5-hexahydropyrido[2,3-f]quinoxaline |
| SMILES | C1=c2cccnc2=C2NCCNC2C1 |
| InChI | InChI=1S/C11H13N3/c1-2-8-3-4-9-11(10(8)13-5-1)14-7-6-12-9/h1-3,5,9,12,14H,4,6-7H2 |
| InChIKey | LXOIIFSNBLIVKQ-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |