C17H19FN2O2 — CID 67302905
N-[4-[4-[(6-fluoro-3-pyridinyl)oxy]phenyl]butan-2-yl]acetamide (PubChem CID 67302905) has the molecular formula C17H19FN2O2 and a molecular weight of 302.35 g/mol. Its IUPAC name is N-[4-[4-[(6-fluoro-3-pyridinyl)oxy]phenyl]butan-2-yl]acetamide.
| Compound Name | N-[4-[4-[(6-fluoro-3-pyridinyl)oxy]phenyl]butan-2-yl]acetamide |
|---|---|
| PubChem CID | 67302905 |
| Molecular Formula | C17H19FN2O2 |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | N-[4-[4-[(6-fluoro-3-pyridinyl)oxy]phenyl]butan-2-yl]acetamide |
| SMILES | CC(=O)NC(C)CCc1ccc(Oc2ccc(F)nc2)cc1 |
| InChI | InChI=1S/C17H19FN2O2/c1-12(20-13(2)21)3-4-14-5-7-15(8-6-14)22-16-9-10-17(18)19-11-16/h5-12H,3-4H2,1-2H3,(H,20,21) |
| InChIKey | RQDLGRLNNXGSAV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|