C24H28N2O2 — CID 67303423
2-[(1S,3S)-5-hydroxy-2-adamantyl]-4,4-dimethyl-1-naphthalen-2-yldiazetidin-3-one (PubChem CID 67303423) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 2-[(1S,3S)-5-hydroxy-2-adamantyl]-4,4-dimethyl-1-naphthalen-2-yldiazetidin-3-one.
| Compound Name | 2-[(1S,3S)-5-hydroxy-2-adamantyl]-4,4-dimethyl-1-naphthalen-2-yldiazetidin-3-one |
|---|---|
| PubChem CID | 67303423 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 2-[(1S,3S)-5-hydroxy-2-adamantyl]-4,4-dimethyl-1-naphthalen-2-yldiazetidin-3-one |
| SMILES | CC1(C)C(=O)N(C2[C@H]3CC4C[C@H]2CC(O)(C4)C3)N1c1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H28N2O2/c1-23(2)22(27)25(21-18-9-15-10-19(21)14-24(28,12-15)13-18)26(23)20-8-7-16-5-3-4-6-17(16)11-20/h3-8,11,15,18-19,21,28H,9-10,12-14H2,1-2H3/t15?,18-,19-,21?,24?/m0/s1 |
| InChIKey | ZNKBUCIDTJDXPN-YJLZUROBSA-N |
| XLogP | 4.12 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |