About 3-bromo-N-propyl-1,2-oxazol-5-amine
3-bromo-N-propyl-1,2-oxazol-5-amine (PubChem CID 67303466) has the molecular formula C6H9BrN2O
and a molecular weight of 205.05 g/mol. Its IUPAC name is 3-bromo-N-propyl-1,2-oxazol-5-amine.
Molecular Properties
| Compound Name | 3-bromo-N-propyl-1,2-oxazol-5-amine |
| PubChem CID | 67303466 |
| Molecular Formula | C6H9BrN2O |
| Molecular Weight | 205.05 g/mol |
| Exact Mass | 203.99 |
| IUPAC Name | 3-bromo-N-propyl-1,2-oxazol-5-amine |
| SMILES | CCCNc1cc(Br)no1 |
| InChI | InChI=1S/C6H9BrN2O/c1-2-3-8-6-4-5(7)9-10-6/h4,8H,2-3H2,1H3 |
| InChIKey | VTRGYSCGXROJMD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.05 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-bromo-N-propyl-1,2-oxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N-propyl-1,2-oxazol-5-amine?
The IUPAC name of 3-bromo-N-propyl-1,2-oxazol-5-amine (CID 67303466) is 3-bromo-N-propyl-1,2-oxazol-5-amine.
What is the SMILES notation for 3-bromo-N-propyl-1,2-oxazol-5-amine?
The canonical SMILES for 3-bromo-N-propyl-1,2-oxazol-5-amine is CCCNc1cc(Br)no1.
What is the InChIKey of 3-bromo-N-propyl-1,2-oxazol-5-amine?
The InChIKey is VTRGYSCGXROJMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9BrN2O/c1-2-3-8-6-4-5(7)9-10-6/h4,8H,2-3H2,1H3.
What are the key properties of 3-bromo-N-propyl-1,2-oxazol-5-amine?
3-bromo-N-propyl-1,2-oxazol-5-amine has a molecular weight of 205.05 g/mol, XLogP of 2.26, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N-propyl-1,2-oxazol-5-amine is sourced from PubChem (CID 67303466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).