C11H20N2O — CID 67303599
1,1-dicyclopentylurea (PubChem CID 67303599) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is 1,1-dicyclopentylurea.
| Compound Name | 1,1-dicyclopentylurea |
|---|---|
| PubChem CID | 67303599 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 1,1-dicyclopentylurea |
| SMILES | NC(=O)N(C1CCCC1)C1CCCC1 |
| InChI | InChI=1S/C11H20N2O/c12-11(14)13(9-5-1-2-6-9)10-7-3-4-8-10/h9-10H,1-8H2,(H2,12,14) |
| InChIKey | OOGXPMMEOMYRNL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |