About [2-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl] N-tert-butylcarbamate
[2-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl] N-tert-butylcarbamate (PubChem CID 67303621) has the molecular formula C13H14F3N3O2
and a molecular weight of 301.27 g/mol. Its IUPAC name is [2-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl] N-tert-butylcarbamate.
Molecular Properties
| Compound Name | [2-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl] N-tert-butylcarbamate |
| PubChem CID | 67303621 |
| Molecular Formula | C13H14F3N3O2 |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | [2-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)Oc1cccn2cc(C(F)(F)F)nc12 |
| InChI | InChI=1S/C13H14F3N3O2/c1-12(2,3)18-11(20)21-8-5-4-6-19-7-9(13(14,15)16)17-10(8)19/h4-7H,1-3H3,(H,18,20) |
| InChIKey | GQTGIVMTVLQNFM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl] N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl] N-tert-butylcarbamate?
The IUPAC name of [2-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl] N-tert-butylcarbamate (CID 67303621) is [2-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl] N-tert-butylcarbamate.
What is the SMILES notation for [2-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl] N-tert-butylcarbamate?
The canonical SMILES for [2-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl] N-tert-butylcarbamate is CC(C)(C)NC(=O)Oc1cccn2cc(C(F)(F)F)nc12.
What is the InChIKey of [2-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl] N-tert-butylcarbamate?
The InChIKey is GQTGIVMTVLQNFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F3N3O2/c1-12(2,3)18-11(20)21-8-5-4-6-19-7-9(13(14,15)16)17-10(8)19/h4-7H,1-3H3,(H,18,20).
What are the key properties of [2-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl] N-tert-butylcarbamate?
[2-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl] N-tert-butylcarbamate has a molecular weight of 301.27 g/mol, XLogP of 3.24, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(trifluoromethyl)imidazo[1,2-a]pyridin-8-yl] N-tert-butylcarbamate is sourced from PubChem (CID 67303621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).