C20H26ClN3O2S — CID 67303784
N-[4-chloro-3-(piperidin-1-ylamino)phenyl]-4-propan-2-ylbenzenesulfonamide (PubChem CID 67303784) has the molecular formula C20H26ClN3O2S and a molecular weight of 407.97 g/mol. Its IUPAC name is N-[4-chloro-3-(piperidin-1-ylamino)phenyl]-4-propan-2-ylbenzenesulfonamide.
| Compound Name | N-[4-chloro-3-(piperidin-1-ylamino)phenyl]-4-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 67303784 |
| Molecular Formula | C20H26ClN3O2S |
| Molecular Weight | 407.97 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | N-[4-chloro-3-(piperidin-1-ylamino)phenyl]-4-propan-2-ylbenzenesulfonamide |
| SMILES | CC(C)c1ccc(S(=O)(=O)Nc2ccc(Cl)c(NN3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C20H26ClN3O2S/c1-15(2)16-6-9-18(10-7-16)27(25,26)23-17-8-11-19(21)20(14-17)22-24-12-4-3-5-13-24/h6-11,14-15,22-23H,3-5,12-13H2,1-2H3 |
| InChIKey | AHHISAWLJSANDT-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.97 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |