About (4R)-6,8-dibromo-3,4-dihydro-2H-chromen-4-amine
(4R)-6,8-dibromo-3,4-dihydro-2H-chromen-4-amine (PubChem CID 67303952) has the molecular formula C9H9Br2NO
and a molecular weight of 306.99 g/mol. Its IUPAC name is (4R)-6,8-dibromo-3,4-dihydro-2H-chromen-4-amine.
Molecular Properties
| Compound Name | (4R)-6,8-dibromo-3,4-dihydro-2H-chromen-4-amine |
| PubChem CID | 67303952 |
| Molecular Formula | C9H9Br2NO |
| Molecular Weight | 306.99 g/mol |
| Exact Mass | 304.91 |
| IUPAC Name | (4R)-6,8-dibromo-3,4-dihydro-2H-chromen-4-amine |
| SMILES | N[C@@H]1CCOc2c(Br)cc(Br)cc21 |
| InChI | InChI=1S/C9H9Br2NO/c10-5-3-6-8(12)1-2-13-9(6)7(11)4-5/h3-4,8H,1-2,12H2/t8-/m1/s1 |
| InChIKey | APVVAAYLNZOHRU-MRVPVSSYSA-N |
| XLogP | 2.99 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.99 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-6,8-dibromo-3,4-dihydro-2H-chromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-6,8-dibromo-3,4-dihydro-2H-chromen-4-amine?
The IUPAC name of (4R)-6,8-dibromo-3,4-dihydro-2H-chromen-4-amine (CID 67303952) is (4R)-6,8-dibromo-3,4-dihydro-2H-chromen-4-amine.
What is the SMILES notation for (4R)-6,8-dibromo-3,4-dihydro-2H-chromen-4-amine?
The canonical SMILES for (4R)-6,8-dibromo-3,4-dihydro-2H-chromen-4-amine is N[C@@H]1CCOc2c(Br)cc(Br)cc21.
What is the InChIKey of (4R)-6,8-dibromo-3,4-dihydro-2H-chromen-4-amine?
The InChIKey is APVVAAYLNZOHRU-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H9Br2NO/c10-5-3-6-8(12)1-2-13-9(6)7(11)4-5/h3-4,8H,1-2,12H2/t8-/m1/s1.
What are the key properties of (4R)-6,8-dibromo-3,4-dihydro-2H-chromen-4-amine?
(4R)-6,8-dibromo-3,4-dihydro-2H-chromen-4-amine has a molecular weight of 306.99 g/mol, XLogP of 2.99, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-6,8-dibromo-3,4-dihydro-2H-chromen-4-amine is sourced from PubChem (CID 67303952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).