C21H34FNO4Si — CID 67305135
[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-(3-fluorophenyl)-5,5-dimethyl-4-oxohexan-2-yl]carbamic acid (PubChem CID 67305135) has the molecular formula C21H34FNO4Si and a molecular weight of 411.59 g/mol. Its IUPAC name is [(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-(3-fluorophenyl)-5,5-dimethyl-4-oxohexan-2-yl]carbamic acid.
| Compound Name | [(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-(3-fluorophenyl)-5,5-dimethyl-4-oxohexan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 67305135 |
| Molecular Formula | C21H34FNO4Si |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | [(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-(3-fluorophenyl)-5,5-dimethyl-4-oxohexan-2-yl]carbamic acid |
| SMILES | CC(C)(C)C(=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](Cc1cccc(F)c1)NC(=O)O |
| InChI | InChI=1S/C21H34FNO4Si/c1-20(2,3)18(24)17(27-28(7,8)21(4,5)6)16(23-19(25)26)13-14-10-9-11-15(22)12-14/h9-12,16-17,23H,13H2,1-8H3,(H,25,26)/t16-,17-/m0/s1 |
| InChIKey | CZQYLLMSODFBDB-IRXDYDNUSA-N |
| XLogP | 5.01 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|