About trimethyl-[(1R,2R)-2-pent-4-enylcyclopropyl]oxysilane
trimethyl-[(1R,2R)-2-pent-4-enylcyclopropyl]oxysilane (PubChem CID 67305364) has the molecular formula C11H22OSi
and a molecular weight of 198.38 g/mol. Its IUPAC name is trimethyl-[(1R,2R)-2-pent-4-enylcyclopropyl]oxysilane.
Molecular Properties
| Compound Name | trimethyl-[(1R,2R)-2-pent-4-enylcyclopropyl]oxysilane |
| PubChem CID | 67305364 |
| Molecular Formula | C11H22OSi |
| Molecular Weight | 198.38 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | trimethyl-[(1R,2R)-2-pent-4-enylcyclopropyl]oxysilane |
| SMILES | C=CCCC[C@@H]1C[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C11H22OSi/c1-5-6-7-8-10-9-11(10)12-13(2,3)4/h5,10-11H,1,6-9H2,2-4H3/t10-,11-/m1/s1 |
| InChIKey | YRMKWXRKLOZRHT-GHMZBOCLSA-N |
| XLogP | 3.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[(1R,2R)-2-pent-4-enylcyclopropyl]oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[(1R,2R)-2-pent-4-enylcyclopropyl]oxysilane?
The IUPAC name of trimethyl-[(1R,2R)-2-pent-4-enylcyclopropyl]oxysilane (CID 67305364) is trimethyl-[(1R,2R)-2-pent-4-enylcyclopropyl]oxysilane.
What is the SMILES notation for trimethyl-[(1R,2R)-2-pent-4-enylcyclopropyl]oxysilane?
The canonical SMILES for trimethyl-[(1R,2R)-2-pent-4-enylcyclopropyl]oxysilane is C=CCCC[C@@H]1C[C@H]1O[Si](C)(C)C.
What is the InChIKey of trimethyl-[(1R,2R)-2-pent-4-enylcyclopropyl]oxysilane?
The InChIKey is YRMKWXRKLOZRHT-GHMZBOCLSA-N. The full InChI is InChI=1S/C11H22OSi/c1-5-6-7-8-10-9-11(10)12-13(2,3)4/h5,10-11H,1,6-9H2,2-4H3/t10-,11-/m1/s1.
What are the key properties of trimethyl-[(1R,2R)-2-pent-4-enylcyclopropyl]oxysilane?
trimethyl-[(1R,2R)-2-pent-4-enylcyclopropyl]oxysilane has a molecular weight of 198.38 g/mol, XLogP of 3.58, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[(1R,2R)-2-pent-4-enylcyclopropyl]oxysilane is sourced from PubChem (CID 67305364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).