C22H30F3N3O3 — CID 67305512
5-[4-amino-3-(4,4-dimethylcyclohexen-1-yl)phenyl]-1,3-dimethyl-1,3-diazinan-2-one;2,2,2-trifluoroacetic acid (PubChem CID 67305512) has the molecular formula C22H30F3N3O3 and a molecular weight of 441.49 g/mol. Its IUPAC name is 5-[4-amino-3-(4,4-dimethylcyclohexen-1-yl)phenyl]-1,3-dimethyl-1,3-diazinan-2-one;2,2,2-trifluoroacetic acid.
| Compound Name | 5-[4-amino-3-(4,4-dimethylcyclohexen-1-yl)phenyl]-1,3-dimethyl-1,3-diazinan-2-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67305512 |
| Molecular Formula | C22H30F3N3O3 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 5-[4-amino-3-(4,4-dimethylcyclohexen-1-yl)phenyl]-1,3-dimethyl-1,3-diazinan-2-one;2,2,2-trifluoroacetic acid |
| SMILES | CN1CC(c2ccc(N)c(C3=CCC(C)(C)CC3)c2)CN(C)C1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H29N3O.C2HF3O2/c1-20(2)9-7-14(8-10-20)17-11-15(5-6-18(17)21)16-12-22(3)19(24)23(4)13-16;3-2(4,5)1(6)7/h5-7,11,16H,8-10,12-13,21H2,1-4H3;(H,6,7) |
| InChIKey | PCMZWSRUNUOLDK-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|