C18H22F3N3O3 — CID 67305549
5-[4-amino-3-(cyclohexen-1-yl)phenyl]-1,3-diazinan-2-one;2,2,2-trifluoroacetic acid (PubChem CID 67305549) has the molecular formula C18H22F3N3O3 and a molecular weight of 385.39 g/mol. Its IUPAC name is 5-[4-amino-3-(cyclohexen-1-yl)phenyl]-1,3-diazinan-2-one;2,2,2-trifluoroacetic acid.
| Compound Name | 5-[4-amino-3-(cyclohexen-1-yl)phenyl]-1,3-diazinan-2-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67305549 |
| Molecular Formula | C18H22F3N3O3 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 5-[4-amino-3-(cyclohexen-1-yl)phenyl]-1,3-diazinan-2-one;2,2,2-trifluoroacetic acid |
| SMILES | Nc1ccc(C2CNC(=O)NC2)cc1C1=CCCCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H21N3O.C2HF3O2/c17-15-7-6-12(13-9-18-16(20)19-10-13)8-14(15)11-4-2-1-3-5-11;3-2(4,5)1(6)7/h4,6-8,13H,1-3,5,9-10,17H2,(H2,18,19,20);(H,6,7) |
| InChIKey | RTLDPCDCWOAFSH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|