C27H26N2O5 — CID 67306285
2-[5-[4-[(2-methoxybenzoyl)amino]phenyl]-3-oxo-1H-isoindol-2-yl]-3-methylbutanoic acid (PubChem CID 67306285) has the molecular formula C27H26N2O5 and a molecular weight of 458.51 g/mol. Its IUPAC name is 2-[5-[4-[(2-methoxybenzoyl)amino]phenyl]-3-oxo-1H-isoindol-2-yl]-3-methylbutanoic acid.
| Compound Name | 2-[5-[4-[(2-methoxybenzoyl)amino]phenyl]-3-oxo-1H-isoindol-2-yl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 67306285 |
| Molecular Formula | C27H26N2O5 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 2-[5-[4-[(2-methoxybenzoyl)amino]phenyl]-3-oxo-1H-isoindol-2-yl]-3-methylbutanoic acid |
| SMILES | COc1ccccc1C(=O)Nc1ccc(-c2ccc3c(c2)C(=O)N(C(C(=O)O)C(C)C)C3)cc1 |
| InChI | InChI=1S/C27H26N2O5/c1-16(2)24(27(32)33)29-15-19-9-8-18(14-22(19)26(29)31)17-10-12-20(13-11-17)28-25(30)21-6-4-5-7-23(21)34-3/h4-14,16,24H,15H2,1-3H3,(H,28,30)(H,32,33) |
| InChIKey | LKHCYMSLVPDPBI-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |