C17H20FN7O3 — CID 67306473
8-(4-fluorophenyl)-3-[3-(2-hydroxyethylamino)propylamino]-6-methylpyrimido[5,4-e][1,2,4]triazine-5,7-dione (PubChem CID 67306473) has the molecular formula C17H20FN7O3 and a molecular weight of 389.39 g/mol. Its IUPAC name is 8-(4-fluorophenyl)-3-[3-(2-hydroxyethylamino)propylamino]-6-methylpyrimido[5,4-e][1,2,4]triazine-5,7-dione.
| Compound Name | 8-(4-fluorophenyl)-3-[3-(2-hydroxyethylamino)propylamino]-6-methylpyrimido[5,4-e][1,2,4]triazine-5,7-dione |
|---|---|
| PubChem CID | 67306473 |
| Molecular Formula | C17H20FN7O3 |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 8-(4-fluorophenyl)-3-[3-(2-hydroxyethylamino)propylamino]-6-methylpyrimido[5,4-e][1,2,4]triazine-5,7-dione |
| SMILES | Cn1c(=O)c2nc(NCCCNCCO)nnc2n(-c2ccc(F)cc2)c1=O |
| InChI | InChI=1S/C17H20FN7O3/c1-24-15(27)13-14(25(17(24)28)12-5-3-11(18)4-6-12)22-23-16(21-13)20-8-2-7-19-9-10-26/h3-6,19,26H,2,7-10H2,1H3,(H,20,21,23) |
| InChIKey | IMESNXJDQRKUHZ-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 126.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|