About (1-ethylthieno[2,3-d]pyrazol-5-yl)methanamine;hydrochloride
(1-ethylthieno[2,3-d]pyrazol-5-yl)methanamine;hydrochloride (PubChem CID 67306539) has the molecular formula C8H12ClN3S
and a molecular weight of 217.72 g/mol. Its IUPAC name is (1-ethylthieno[2,3-d]pyrazol-5-yl)methanamine;hydrochloride.
Molecular Properties
| Compound Name | (1-ethylthieno[2,3-d]pyrazol-5-yl)methanamine;hydrochloride |
| PubChem CID | 67306539 |
| Molecular Formula | C8H12ClN3S |
| Molecular Weight | 217.72 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | (1-ethylthieno[2,3-d]pyrazol-5-yl)methanamine;hydrochloride |
| SMILES | CCn1ncc2sc(CN)cc21.Cl |
| InChI | InChI=1S/C8H11N3S.ClH/c1-2-11-7-3-6(4-9)12-8(7)5-10-11;/h3,5H,2,4,9H2,1H3;1H |
| InChIKey | WLIFXHPTOYQOTP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.72 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-ethylthieno[2,3-d]pyrazol-5-yl)methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethylthieno[2,3-d]pyrazol-5-yl)methanamine;hydrochloride?
The IUPAC name of (1-ethylthieno[2,3-d]pyrazol-5-yl)methanamine;hydrochloride (CID 67306539) is (1-ethylthieno[2,3-d]pyrazol-5-yl)methanamine;hydrochloride.
What is the SMILES notation for (1-ethylthieno[2,3-d]pyrazol-5-yl)methanamine;hydrochloride?
The canonical SMILES for (1-ethylthieno[2,3-d]pyrazol-5-yl)methanamine;hydrochloride is CCn1ncc2sc(CN)cc21.Cl.
What is the InChIKey of (1-ethylthieno[2,3-d]pyrazol-5-yl)methanamine;hydrochloride?
The InChIKey is WLIFXHPTOYQOTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3S.ClH/c1-2-11-7-3-6(4-9)12-8(7)5-10-11;/h3,5H,2,4,9H2,1H3;1H.
What are the key properties of (1-ethylthieno[2,3-d]pyrazol-5-yl)methanamine;hydrochloride?
(1-ethylthieno[2,3-d]pyrazol-5-yl)methanamine;hydrochloride has a molecular weight of 217.72 g/mol, XLogP of 2.00, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethylthieno[2,3-d]pyrazol-5-yl)methanamine;hydrochloride is sourced from PubChem (CID 67306539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).