About thieno[3,2-c]pyridin-2-ylmethanamine
thieno[3,2-c]pyridin-2-ylmethanamine (PubChem CID 67306704) has the molecular formula C8H8N2S
and a molecular weight of 164.23 g/mol. Its IUPAC name is thieno[3,2-c]pyridin-2-ylmethanamine.
Molecular Properties
| Compound Name | thieno[3,2-c]pyridin-2-ylmethanamine |
| PubChem CID | 67306704 |
| Molecular Formula | C8H8N2S |
| Molecular Weight | 164.23 g/mol |
| Exact Mass | 164.04 |
| IUPAC Name | thieno[3,2-c]pyridin-2-ylmethanamine |
| SMILES | NCc1cc2cnccc2s1 |
| InChI | InChI=1S/C8H8N2S/c9-4-7-3-6-5-10-2-1-8(6)11-7/h1-3,5H,4,9H2 |
| InChIKey | MWPZMIAZMPWLHW-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.23 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze thieno[3,2-c]pyridin-2-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thieno[3,2-c]pyridin-2-ylmethanamine?
The IUPAC name of thieno[3,2-c]pyridin-2-ylmethanamine (CID 67306704) is thieno[3,2-c]pyridin-2-ylmethanamine.
What is the SMILES notation for thieno[3,2-c]pyridin-2-ylmethanamine?
The canonical SMILES for thieno[3,2-c]pyridin-2-ylmethanamine is NCc1cc2cnccc2s1.
What is the InChIKey of thieno[3,2-c]pyridin-2-ylmethanamine?
The InChIKey is MWPZMIAZMPWLHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2S/c9-4-7-3-6-5-10-2-1-8(6)11-7/h1-3,5H,4,9H2.
What are the key properties of thieno[3,2-c]pyridin-2-ylmethanamine?
thieno[3,2-c]pyridin-2-ylmethanamine has a molecular weight of 164.23 g/mol, XLogP of 1.75, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[3,2-c]pyridin-2-ylmethanamine is sourced from PubChem (CID 67306704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).