C14H15F3NNaO5 — CID 67306964
sodium (1S,5S,8aS,8bR)-5-methoxy-2-oxo-1-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate (PubChem CID 67306964) has the molecular formula C14H15F3NNaO5 and a molecular weight of 357.26 g/mol. Its IUPAC name is sodium (1S,5S,8aS,8bR)-5-methoxy-2-oxo-1-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate.
| Compound Name | sodium (1S,5S,8aS,8bR)-5-methoxy-2-oxo-1-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate |
|---|---|
| PubChem CID | 67306964 |
| Molecular Formula | C14H15F3NNaO5 |
| Molecular Weight | 357.26 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | sodium (1S,5S,8aS,8bR)-5-methoxy-2-oxo-1-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate |
| SMILES | CO[C@H]1CCC[C@H]2C1=C(C(=O)[O-])N1C(=O)[C@H]([C@H](O)C(F)(F)F)[C@@H]21.[Na+] |
| InChI | InChI=1S/C14H16F3NO5.Na/c1-23-6-4-2-3-5-7(6)10(13(21)22)18-9(5)8(12(18)20)11(19)14(15,16)17;/h5-6,8-9,11,19H,2-4H2,1H3,(H,21,22);/q;+1/p-1/t5-,6-,8-,9+,11-;/m0./s1 |
| InChIKey | UZPGJFNHIDZDGN-BGDQHZHDSA-M |
| XLogP | -3.43 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.26 |
| LogP ≤ 5 | -3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |