C21H28FN7O3 — CID 67307174
3-[3-[2-(diethylamino)ethylamino]propoxy]-8-(4-fluorophenyl)-6-methylpyrimido[5,4-e][1,2,4]triazine-5,7-dione (PubChem CID 67307174) has the molecular formula C21H28FN7O3 and a molecular weight of 445.50 g/mol. Its IUPAC name is 3-[3-[2-(diethylamino)ethylamino]propoxy]-8-(4-fluorophenyl)-6-methylpyrimido[5,4-e][1,2,4]triazine-5,7-dione.
| Compound Name | 3-[3-[2-(diethylamino)ethylamino]propoxy]-8-(4-fluorophenyl)-6-methylpyrimido[5,4-e][1,2,4]triazine-5,7-dione |
|---|---|
| PubChem CID | 67307174 |
| Molecular Formula | C21H28FN7O3 |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | 3-[3-[2-(diethylamino)ethylamino]propoxy]-8-(4-fluorophenyl)-6-methylpyrimido[5,4-e][1,2,4]triazine-5,7-dione |
| SMILES | CCN(CC)CCNCCCOc1nnc2c(n1)c(=O)n(C)c(=O)n2-c1ccc(F)cc1 |
| InChI | InChI=1S/C21H28FN7O3/c1-4-28(5-2)13-12-23-11-6-14-32-20-24-17-18(25-26-20)29(21(31)27(3)19(17)30)16-9-7-15(22)8-10-16/h7-10,23H,4-6,11-14H2,1-3H3 |
| InChIKey | CAVMXWNPOACFFV-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 107.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|