C19H23FN8O2 — CID 67307479
8-(4-fluorophenyl)-6-methyl-3-(3-piperazin-1-ylpropylamino)pyrimido[5,4-e][1,2,4]triazine-5,7-dione (PubChem CID 67307479) has the molecular formula C19H23FN8O2 and a molecular weight of 414.45 g/mol. Its IUPAC name is 8-(4-fluorophenyl)-6-methyl-3-(3-piperazin-1-ylpropylamino)pyrimido[5,4-e][1,2,4]triazine-5,7-dione.
| Compound Name | 8-(4-fluorophenyl)-6-methyl-3-(3-piperazin-1-ylpropylamino)pyrimido[5,4-e][1,2,4]triazine-5,7-dione |
|---|---|
| PubChem CID | 67307479 |
| Molecular Formula | C19H23FN8O2 |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 8-(4-fluorophenyl)-6-methyl-3-(3-piperazin-1-ylpropylamino)pyrimido[5,4-e][1,2,4]triazine-5,7-dione |
| SMILES | Cn1c(=O)c2nc(NCCCN3CCNCC3)nnc2n(-c2ccc(F)cc2)c1=O |
| InChI | InChI=1S/C19H23FN8O2/c1-26-17(29)15-16(28(19(26)30)14-5-3-13(20)4-6-14)24-25-18(23-15)22-7-2-10-27-11-8-21-9-12-27/h3-6,21H,2,7-12H2,1H3,(H,22,23,25) |
| InChIKey | SBOKBAFUQVTQAG-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 109.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|