C20H25N7O2 — CID 67307856
3-[4-(3-aminopropylamino)phenyl]-8-cyclopentyl-6-methylpyrimido[5,4-e][1,2,4]triazine-5,7-dione (PubChem CID 67307856) has the molecular formula C20H25N7O2 and a molecular weight of 395.47 g/mol. Its IUPAC name is 3-[4-(3-aminopropylamino)phenyl]-8-cyclopentyl-6-methylpyrimido[5,4-e][1,2,4]triazine-5,7-dione.
| Compound Name | 3-[4-(3-aminopropylamino)phenyl]-8-cyclopentyl-6-methylpyrimido[5,4-e][1,2,4]triazine-5,7-dione |
|---|---|
| PubChem CID | 67307856 |
| Molecular Formula | C20H25N7O2 |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 3-[4-(3-aminopropylamino)phenyl]-8-cyclopentyl-6-methylpyrimido[5,4-e][1,2,4]triazine-5,7-dione |
| SMILES | Cn1c(=O)c2nc(-c3ccc(NCCCN)cc3)nnc2n(C2CCCC2)c1=O |
| InChI | InChI=1S/C20H25N7O2/c1-26-19(28)16-18(27(20(26)29)15-5-2-3-6-15)25-24-17(23-16)13-7-9-14(10-8-13)22-12-4-11-21/h7-10,15,22H,2-6,11-12,21H2,1H3 |
| InChIKey | QMKLRAWMUUGWAG-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|