C13H24F3NO4Si2 — CID 67307961
[(2R,3R)-4-oxo-3-[(1S)-2,2,2-trifluoro-1-trimethylsilyloxyethyl]-1-trimethylsilylazetidin-2-yl] acetate (PubChem CID 67307961) has the molecular formula C13H24F3NO4Si2 and a molecular weight of 371.50 g/mol. Its IUPAC name is [(2R,3R)-4-oxo-3-[(1S)-2,2,2-trifluoro-1-trimethylsilyloxyethyl]-1-trimethylsilylazetidin-2-yl] acetate.
| Compound Name | [(2R,3R)-4-oxo-3-[(1S)-2,2,2-trifluoro-1-trimethylsilyloxyethyl]-1-trimethylsilylazetidin-2-yl] acetate |
|---|---|
| PubChem CID | 67307961 |
| Molecular Formula | C13H24F3NO4Si2 |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | [(2R,3R)-4-oxo-3-[(1S)-2,2,2-trifluoro-1-trimethylsilyloxyethyl]-1-trimethylsilylazetidin-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H]([C@H](O[Si](C)(C)C)C(F)(F)F)C(=O)N1[Si](C)(C)C |
| InChI | InChI=1S/C13H24F3NO4Si2/c1-8(18)20-12-9(11(19)17(12)22(2,3)4)10(13(14,15)16)21-23(5,6)7/h9-10,12H,1-7H3/t9-,10-,12+/m0/s1 |
| InChIKey | DJLGNEHORONSMV-JBLDHEPKSA-N |
| XLogP | 2.95 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|