C27H28F2N8O3 — CID 67307999
4-[8-[(3,4-difluorophenyl)methyl]-6-methyl-5,7-dioxopyrimido[5,4-e][1,2,4]triazin-3-yl]-N-(3-piperazin-1-ylpropyl)benzamide (PubChem CID 67307999) has the molecular formula C27H28F2N8O3 and a molecular weight of 550.57 g/mol. Its IUPAC name is 4-[8-[(3,4-difluorophenyl)methyl]-6-methyl-5,7-dioxopyrimido[5,4-e][1,2,4]triazin-3-yl]-N-(3-piperazin-1-ylpropyl)benzamide.
| Compound Name | 4-[8-[(3,4-difluorophenyl)methyl]-6-methyl-5,7-dioxopyrimido[5,4-e][1,2,4]triazin-3-yl]-N-(3-piperazin-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 67307999 |
| Molecular Formula | C27H28F2N8O3 |
| Molecular Weight | 550.57 g/mol |
| Exact Mass | 550.23 |
| IUPAC Name | 4-[8-[(3,4-difluorophenyl)methyl]-6-methyl-5,7-dioxopyrimido[5,4-e][1,2,4]triazin-3-yl]-N-(3-piperazin-1-ylpropyl)benzamide |
| SMILES | Cn1c(=O)c2nc(-c3ccc(C(=O)NCCCN4CCNCC4)cc3)nnc2n(Cc2ccc(F)c(F)c2)c1=O |
| InChI | InChI=1S/C27H28F2N8O3/c1-35-26(39)22-24(37(27(35)40)16-17-3-8-20(28)21(29)15-17)34-33-23(32-22)18-4-6-19(7-5-18)25(38)31-9-2-12-36-13-10-30-11-14-36/h3-8,15,30H,2,9-14,16H2,1H3,(H,31,38) |
| InChIKey | PJSRHYONKCWNCX-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 127.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.57 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|