C15H23N7O3 — CID 67308003
N-[3-(diethylamino)propyl]-6,8-dimethyl-5,7-dioxopyrimido[5,4-e][1,2,4]triazine-3-carboxamide (PubChem CID 67308003) has the molecular formula C15H23N7O3 and a molecular weight of 349.40 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-6,8-dimethyl-5,7-dioxopyrimido[5,4-e][1,2,4]triazine-3-carboxamide.
| Compound Name | N-[3-(diethylamino)propyl]-6,8-dimethyl-5,7-dioxopyrimido[5,4-e][1,2,4]triazine-3-carboxamide |
|---|---|
| PubChem CID | 67308003 |
| Molecular Formula | C15H23N7O3 |
| Molecular Weight | 349.40 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | N-[3-(diethylamino)propyl]-6,8-dimethyl-5,7-dioxopyrimido[5,4-e][1,2,4]triazine-3-carboxamide |
| SMILES | CCN(CC)CCCNC(=O)c1nnc2c(n1)c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C15H23N7O3/c1-5-22(6-2)9-7-8-16-13(23)11-17-10-12(19-18-11)20(3)15(25)21(4)14(10)24/h5-9H2,1-4H3,(H,16,23) |
| InChIKey | CTMZERQRUPDBAR-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 115.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.40 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|