C16H24N6O3 — CID 67308025
8-cyclopentyl-3-[3-(dimethylamino)propoxy]-6-methylpyrimido[5,4-e][1,2,4]triazine-5,7-dione (PubChem CID 67308025) has the molecular formula C16H24N6O3 and a molecular weight of 348.41 g/mol. Its IUPAC name is 8-cyclopentyl-3-[3-(dimethylamino)propoxy]-6-methylpyrimido[5,4-e][1,2,4]triazine-5,7-dione.
| Compound Name | 8-cyclopentyl-3-[3-(dimethylamino)propoxy]-6-methylpyrimido[5,4-e][1,2,4]triazine-5,7-dione |
|---|---|
| PubChem CID | 67308025 |
| Molecular Formula | C16H24N6O3 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | 8-cyclopentyl-3-[3-(dimethylamino)propoxy]-6-methylpyrimido[5,4-e][1,2,4]triazine-5,7-dione |
| SMILES | CN(C)CCCOc1nnc2c(n1)c(=O)n(C)c(=O)n2C1CCCC1 |
| InChI | InChI=1S/C16H24N6O3/c1-20(2)9-6-10-25-15-17-12-13(18-19-15)22(11-7-4-5-8-11)16(24)21(3)14(12)23/h11H,4-10H2,1-3H3 |
| InChIKey | MWEGLCKIMIFWSG-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 95.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|