C21H27N7O3 — CID 67308128
6,8-dimethyl-3-[4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]pyrimido[5,4-e][1,2,4]triazine-5,7-dione (PubChem CID 67308128) has the molecular formula C21H27N7O3 and a molecular weight of 425.49 g/mol. Its IUPAC name is 6,8-dimethyl-3-[4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]pyrimido[5,4-e][1,2,4]triazine-5,7-dione.
| Compound Name | 6,8-dimethyl-3-[4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]pyrimido[5,4-e][1,2,4]triazine-5,7-dione |
|---|---|
| PubChem CID | 67308128 |
| Molecular Formula | C21H27N7O3 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 6,8-dimethyl-3-[4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]pyrimido[5,4-e][1,2,4]triazine-5,7-dione |
| SMILES | CN1CCN(CCCOc2ccc(-c3nnc4c(n3)c(=O)n(C)c(=O)n4C)cc2)CC1 |
| InChI | InChI=1S/C21H27N7O3/c1-25-10-12-28(13-11-25)9-4-14-31-16-7-5-15(6-8-16)18-22-17-19(24-23-18)26(2)21(30)27(3)20(17)29/h5-8H,4,9-14H2,1-3H3 |
| InChIKey | WSMDVCAFMBRUHM-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 98.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|