C16H16F2N6O3 — CID 67308353
3-(3-aminopropoxy)-8-[(3,4-difluorophenyl)methyl]-6-methylpyrimido[5,4-e][1,2,4]triazine-5,7-dione (PubChem CID 67308353) has the molecular formula C16H16F2N6O3 and a molecular weight of 378.34 g/mol. Its IUPAC name is 3-(3-aminopropoxy)-8-[(3,4-difluorophenyl)methyl]-6-methylpyrimido[5,4-e][1,2,4]triazine-5,7-dione.
| Compound Name | 3-(3-aminopropoxy)-8-[(3,4-difluorophenyl)methyl]-6-methylpyrimido[5,4-e][1,2,4]triazine-5,7-dione |
|---|---|
| PubChem CID | 67308353 |
| Molecular Formula | C16H16F2N6O3 |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 3-(3-aminopropoxy)-8-[(3,4-difluorophenyl)methyl]-6-methylpyrimido[5,4-e][1,2,4]triazine-5,7-dione |
| SMILES | Cn1c(=O)c2nc(OCCCN)nnc2n(Cc2ccc(F)c(F)c2)c1=O |
| InChI | InChI=1S/C16H16F2N6O3/c1-23-14(25)12-13(21-22-15(20-12)27-6-2-5-19)24(16(23)26)8-9-3-4-10(17)11(18)7-9/h3-4,7H,2,5-6,8,19H2,1H3 |
| InChIKey | YOOALOKBTPLEGR-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 117.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|