C20H31N7O2 — CID 67308429
8-cyclopentyl-6-methyl-3-[(3-piperidin-1-ylpropylamino)methyl]pyrimido[5,4-e][1,2,4]triazine-5,7-dione (PubChem CID 67308429) has the molecular formula C20H31N7O2 and a molecular weight of 401.52 g/mol. Its IUPAC name is 8-cyclopentyl-6-methyl-3-[(3-piperidin-1-ylpropylamino)methyl]pyrimido[5,4-e][1,2,4]triazine-5,7-dione.
| Compound Name | 8-cyclopentyl-6-methyl-3-[(3-piperidin-1-ylpropylamino)methyl]pyrimido[5,4-e][1,2,4]triazine-5,7-dione |
|---|---|
| PubChem CID | 67308429 |
| Molecular Formula | C20H31N7O2 |
| Molecular Weight | 401.52 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | 8-cyclopentyl-6-methyl-3-[(3-piperidin-1-ylpropylamino)methyl]pyrimido[5,4-e][1,2,4]triazine-5,7-dione |
| SMILES | Cn1c(=O)c2nc(CNCCCN3CCCCC3)nnc2n(C2CCCC2)c1=O |
| InChI | InChI=1S/C20H31N7O2/c1-25-19(28)17-18(27(20(25)29)15-8-3-4-9-15)24-23-16(22-17)14-21-10-7-13-26-11-5-2-6-12-26/h15,21H,2-14H2,1H3 |
| InChIKey | PTBORPZEBVXVAC-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 97.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.52 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|