C14H21N7O2 — CID 67308962
3-(3-aminopropylamino)-8-cyclopentyl-6-methylpyrimido[5,4-e][1,2,4]triazine-5,7-dione (PubChem CID 67308962) has the molecular formula C14H21N7O2 and a molecular weight of 319.37 g/mol. Its IUPAC name is 3-(3-aminopropylamino)-8-cyclopentyl-6-methylpyrimido[5,4-e][1,2,4]triazine-5,7-dione.
| Compound Name | 3-(3-aminopropylamino)-8-cyclopentyl-6-methylpyrimido[5,4-e][1,2,4]triazine-5,7-dione |
|---|---|
| PubChem CID | 67308962 |
| Molecular Formula | C14H21N7O2 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 3-(3-aminopropylamino)-8-cyclopentyl-6-methylpyrimido[5,4-e][1,2,4]triazine-5,7-dione |
| SMILES | Cn1c(=O)c2nc(NCCCN)nnc2n(C2CCCC2)c1=O |
| InChI | InChI=1S/C14H21N7O2/c1-20-12(22)10-11(18-19-13(17-10)16-8-4-7-15)21(14(20)23)9-5-2-3-6-9/h9H,2-8,15H2,1H3,(H,16,17,19) |
| InChIKey | HIPJTTBBSPYCNA-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|