C15H12F3N3O2S — CID 67309088
11-[4-(trifluoromethyl)phenyl]sulfonyl-4,5,11-triazatricyclo[6.2.1.02,6]undeca-2(6),3,9-triene (PubChem CID 67309088) has the molecular formula C15H12F3N3O2S and a molecular weight of 355.34 g/mol. Its IUPAC name is 11-[4-(trifluoromethyl)phenyl]sulfonyl-4,5,11-triazatricyclo[6.2.1.02,6]undeca-2(6),3,9-triene.
| Compound Name | 11-[4-(trifluoromethyl)phenyl]sulfonyl-4,5,11-triazatricyclo[6.2.1.02,6]undeca-2(6),3,9-triene |
|---|---|
| PubChem CID | 67309088 |
| Molecular Formula | C15H12F3N3O2S |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | 11-[4-(trifluoromethyl)phenyl]sulfonyl-4,5,11-triazatricyclo[6.2.1.02,6]undeca-2(6),3,9-triene |
| SMILES | O=S(=O)(c1ccc(C(F)(F)F)cc1)N1C2C=CC1c1cn[nH]c1C2 |
| InChI | InChI=1S/C15H12F3N3O2S/c16-15(17,18)9-1-4-11(5-2-9)24(22,23)21-10-3-6-14(21)12-8-19-20-13(12)7-10/h1-6,8,10,14H,7H2,(H,19,20) |
| InChIKey | LCKJGUKNVXOMSY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|