C17H25N — CID 67309389
6-butyl-1,2,3,4,4a,5,6,6a-octahydrophenanthridine (PubChem CID 67309389) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is 6-butyl-1,2,3,4,4a,5,6,6a-octahydrophenanthridine.
| Compound Name | 6-butyl-1,2,3,4,4a,5,6,6a-octahydrophenanthridine |
|---|---|
| PubChem CID | 67309389 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | 6-butyl-1,2,3,4,4a,5,6,6a-octahydrophenanthridine |
| SMILES | CCCCC1NC2CCCCC2=C2C=CC=CC21 |
| InChI | InChI=1S/C17H25N/c1-2-3-11-16-14-9-5-4-8-13(14)15-10-6-7-12-17(15)18-16/h4-5,8-9,14,16-18H,2-3,6-7,10-12H2,1H3 |
| InChIKey | OSTVGBWWGIKRGY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |