C22H22ClN3 — CID 67309981
8-chloro-2-prop-2-enyl-5-(2-pyridin-4-ylprop-1-enyl)-3,4-dihydro-1H-pyrido[4,3-b]indole (PubChem CID 67309981) has the molecular formula C22H22ClN3 and a molecular weight of 363.89 g/mol. Its IUPAC name is 8-chloro-2-prop-2-enyl-5-(2-pyridin-4-ylprop-1-enyl)-3,4-dihydro-1H-pyrido[4,3-b]indole.
| Compound Name | 8-chloro-2-prop-2-enyl-5-(2-pyridin-4-ylprop-1-enyl)-3,4-dihydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 67309981 |
| Molecular Formula | C22H22ClN3 |
| Molecular Weight | 363.89 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 8-chloro-2-prop-2-enyl-5-(2-pyridin-4-ylprop-1-enyl)-3,4-dihydro-1H-pyrido[4,3-b]indole |
| SMILES | C=CCN1CCc2c(c3cc(Cl)ccc3n2C=C(C)c2ccncc2)C1 |
| InChI | InChI=1S/C22H22ClN3/c1-3-11-25-12-8-22-20(15-25)19-13-18(23)4-5-21(19)26(22)14-16(2)17-6-9-24-10-7-17/h3-7,9-10,13-14H,1,8,11-12,15H2,2H3 |
| InChIKey | YYOTUPOHCLMHND-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.89 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|