About 3-ethenyl-2-propyl-2H-1,3-oxazole
3-ethenyl-2-propyl-2H-1,3-oxazole (PubChem CID 67310358) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is 3-ethenyl-2-propyl-2H-1,3-oxazole.
Molecular Properties
| Compound Name | 3-ethenyl-2-propyl-2H-1,3-oxazole |
| PubChem CID | 67310358 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 3-ethenyl-2-propyl-2H-1,3-oxazole |
| SMILES | C=CN1C=COC1CCC |
| InChI | InChI=1S/C8H13NO/c1-3-5-8-9(4-2)6-7-10-8/h4,6-8H,2-3,5H2,1H3 |
| InChIKey | AWAAUJRFKIYTQM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethenyl-2-propyl-2H-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyl-2-propyl-2H-1,3-oxazole?
The IUPAC name of 3-ethenyl-2-propyl-2H-1,3-oxazole (CID 67310358) is 3-ethenyl-2-propyl-2H-1,3-oxazole.
What is the SMILES notation for 3-ethenyl-2-propyl-2H-1,3-oxazole?
The canonical SMILES for 3-ethenyl-2-propyl-2H-1,3-oxazole is C=CN1C=COC1CCC.
What is the InChIKey of 3-ethenyl-2-propyl-2H-1,3-oxazole?
The InChIKey is AWAAUJRFKIYTQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO/c1-3-5-8-9(4-2)6-7-10-8/h4,6-8H,2-3,5H2,1H3.
What are the key properties of 3-ethenyl-2-propyl-2H-1,3-oxazole?
3-ethenyl-2-propyl-2H-1,3-oxazole has a molecular weight of 139.20 g/mol, XLogP of 2.06, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyl-2-propyl-2H-1,3-oxazole is sourced from PubChem (CID 67310358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).