C25H28Cl2N4O2 — CID 67311481
(3R)-1-[(1R,2S)-4,6-dichloro-1-[4-(3,5-dimethyl-1,2,4-triazol-4-yl)-2,3-dimethylphenoxy]-2,3-dihydro-1H-inden-2-yl]pyrrolidin-3-ol (PubChem CID 67311481) has the molecular formula C25H28Cl2N4O2 and a molecular weight of 487.43 g/mol. Its IUPAC name is (3R)-1-[(1R,2S)-4,6-dichloro-1-[4-(3,5-dimethyl-1,2,4-triazol-4-yl)-2,3-dimethylphenoxy]-2,3-dihydro-1H-inden-2-yl]pyrrolidin-3-ol.
| Compound Name | (3R)-1-[(1R,2S)-4,6-dichloro-1-[4-(3,5-dimethyl-1,2,4-triazol-4-yl)-2,3-dimethylphenoxy]-2,3-dihydro-1H-inden-2-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 67311481 |
| Molecular Formula | C25H28Cl2N4O2 |
| Molecular Weight | 487.43 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | (3R)-1-[(1R,2S)-4,6-dichloro-1-[4-(3,5-dimethyl-1,2,4-triazol-4-yl)-2,3-dimethylphenoxy]-2,3-dihydro-1H-inden-2-yl]pyrrolidin-3-ol |
| SMILES | Cc1c(O[C@@H]2c3cc(Cl)cc(Cl)c3C[C@@H]2N2CC[C@@H](O)C2)ccc(-n2c(C)nnc2C)c1C |
| InChI | InChI=1S/C25H28Cl2N4O2/c1-13-14(2)24(6-5-22(13)31-15(3)28-29-16(31)4)33-25-20-9-17(26)10-21(27)19(20)11-23(25)30-8-7-18(32)12-30/h5-6,9-10,18,23,25,32H,7-8,11-12H2,1-4H3/t18-,23+,25-/m1/s1 |
| InChIKey | ZUZCVRDUQAFHEO-FMNCTDSISA-N |
| XLogP | 4.92 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.43 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |