About 2-(1H-pyrazol-5-yl)-1,2-thiazolidine 1,1-dioxide
2-(1H-pyrazol-5-yl)-1,2-thiazolidine 1,1-dioxide (PubChem CID 67312123) has the molecular formula C6H9N3O2S
and a molecular weight of 187.22 g/mol. Its IUPAC name is 2-(1H-pyrazol-5-yl)-1,2-thiazolidine 1,1-dioxide.
Molecular Properties
| Compound Name | 2-(1H-pyrazol-5-yl)-1,2-thiazolidine 1,1-dioxide |
| PubChem CID | 67312123 |
| Molecular Formula | C6H9N3O2S |
| Molecular Weight | 187.22 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | 2-(1H-pyrazol-5-yl)-1,2-thiazolidine 1,1-dioxide |
| SMILES | O=S1(=O)CCCN1c1ccn[nH]1 |
| InChI | InChI=1S/C6H9N3O2S/c10-12(11)5-1-4-9(12)6-2-3-7-8-6/h2-3H,1,4-5H2,(H,7,8) |
| InChIKey | IOHHSZCSELQCQO-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.22 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1H-pyrazol-5-yl)-1,2-thiazolidine 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-pyrazol-5-yl)-1,2-thiazolidine 1,1-dioxide?
The IUPAC name of 2-(1H-pyrazol-5-yl)-1,2-thiazolidine 1,1-dioxide (CID 67312123) is 2-(1H-pyrazol-5-yl)-1,2-thiazolidine 1,1-dioxide.
What is the SMILES notation for 2-(1H-pyrazol-5-yl)-1,2-thiazolidine 1,1-dioxide?
The canonical SMILES for 2-(1H-pyrazol-5-yl)-1,2-thiazolidine 1,1-dioxide is O=S1(=O)CCCN1c1ccn[nH]1.
What is the InChIKey of 2-(1H-pyrazol-5-yl)-1,2-thiazolidine 1,1-dioxide?
The InChIKey is IOHHSZCSELQCQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O2S/c10-12(11)5-1-4-9(12)6-2-3-7-8-6/h2-3H,1,4-5H2,(H,7,8).
What are the key properties of 2-(1H-pyrazol-5-yl)-1,2-thiazolidine 1,1-dioxide?
2-(1H-pyrazol-5-yl)-1,2-thiazolidine 1,1-dioxide has a molecular weight of 187.22 g/mol, XLogP of -0.05, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-pyrazol-5-yl)-1,2-thiazolidine 1,1-dioxide is sourced from PubChem (CID 67312123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).