About 1-(1H-1,2,4-triazol-5-yl)imidazolidin-2-one
1-(1H-1,2,4-triazol-5-yl)imidazolidin-2-one (PubChem CID 67312223) has the molecular formula C5H7N5O
and a molecular weight of 153.15 g/mol. Its IUPAC name is 1-(1H-1,2,4-triazol-5-yl)imidazolidin-2-one.
Molecular Properties
| Compound Name | 1-(1H-1,2,4-triazol-5-yl)imidazolidin-2-one |
| PubChem CID | 67312223 |
| Molecular Formula | C5H7N5O |
| Molecular Weight | 153.15 g/mol |
| Exact Mass | 153.07 |
| IUPAC Name | 1-(1H-1,2,4-triazol-5-yl)imidazolidin-2-one |
| SMILES | O=C1NCCN1c1ncn[nH]1 |
| InChI | InChI=1S/C5H7N5O/c11-5-6-1-2-10(5)4-7-3-8-9-4/h3H,1-2H2,(H,6,11)(H,7,8,9) |
| InChIKey | IXGRSBPLQMIRDZ-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.15 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1H-1,2,4-triazol-5-yl)imidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1H-1,2,4-triazol-5-yl)imidazolidin-2-one?
The IUPAC name of 1-(1H-1,2,4-triazol-5-yl)imidazolidin-2-one (CID 67312223) is 1-(1H-1,2,4-triazol-5-yl)imidazolidin-2-one.
What is the SMILES notation for 1-(1H-1,2,4-triazol-5-yl)imidazolidin-2-one?
The canonical SMILES for 1-(1H-1,2,4-triazol-5-yl)imidazolidin-2-one is O=C1NCCN1c1ncn[nH]1.
What is the InChIKey of 1-(1H-1,2,4-triazol-5-yl)imidazolidin-2-one?
The InChIKey is IXGRSBPLQMIRDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N5O/c11-5-6-1-2-10(5)4-7-3-8-9-4/h3H,1-2H2,(H,6,11)(H,7,8,9).
What are the key properties of 1-(1H-1,2,4-triazol-5-yl)imidazolidin-2-one?
1-(1H-1,2,4-triazol-5-yl)imidazolidin-2-one has a molecular weight of 153.15 g/mol, XLogP of -0.67, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1H-1,2,4-triazol-5-yl)imidazolidin-2-one is sourced from PubChem (CID 67312223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).