C23H26N2 — CID 67312399
2,8-dimethyl-5-[(E)-3-(4-methylphenyl)prop-2-enyl]-3,4-dihydro-1H-pyrido[4,3-b]indole (PubChem CID 67312399) has the molecular formula C23H26N2 and a molecular weight of 330.48 g/mol. Its IUPAC name is 2,8-dimethyl-5-[(E)-3-(4-methylphenyl)prop-2-enyl]-3,4-dihydro-1H-pyrido[4,3-b]indole.
| Compound Name | 2,8-dimethyl-5-[(E)-3-(4-methylphenyl)prop-2-enyl]-3,4-dihydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 67312399 |
| Molecular Formula | C23H26N2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 2,8-dimethyl-5-[(E)-3-(4-methylphenyl)prop-2-enyl]-3,4-dihydro-1H-pyrido[4,3-b]indole |
| SMILES | Cc1ccc(/C=C/Cn2c3c(c4cc(C)ccc42)CN(C)CC3)cc1 |
| InChI | InChI=1S/C23H26N2/c1-17-6-9-19(10-7-17)5-4-13-25-22-11-8-18(2)15-20(22)21-16-24(3)14-12-23(21)25/h4-11,15H,12-14,16H2,1-3H3/b5-4+ |
| InChIKey | SHMKINVFEUFJFP-SNAWJCMRSA-N |
| XLogP | 4.96 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|