C20H20N2O3 — CID 67312689
2-[5-(4-aminophenyl)-3-oxo-1H-isoindol-2-yl]cyclopentane-1-carboxylic acid (PubChem CID 67312689) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is 2-[5-(4-aminophenyl)-3-oxo-1H-isoindol-2-yl]cyclopentane-1-carboxylic acid.
| Compound Name | 2-[5-(4-aminophenyl)-3-oxo-1H-isoindol-2-yl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 67312689 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 2-[5-(4-aminophenyl)-3-oxo-1H-isoindol-2-yl]cyclopentane-1-carboxylic acid |
| SMILES | Nc1ccc(-c2ccc3c(c2)C(=O)N(C2CCCC2C(=O)O)C3)cc1 |
| InChI | InChI=1S/C20H20N2O3/c21-15-8-6-12(7-9-15)13-4-5-14-11-22(19(23)17(14)10-13)18-3-1-2-16(18)20(24)25/h4-10,16,18H,1-3,11,21H2,(H,24,25) |
| InChIKey | PMIJHIUSPQYTOO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|