About bis(1H-imidazol-3-ium);phthalate
bis(1H-imidazol-3-ium);phthalate (PubChem CID 67313532) has the molecular formula C14H14N4O4
and a molecular weight of 302.29 g/mol. Its IUPAC name is bis(1H-imidazol-3-ium);phthalate.
Molecular Properties
| Compound Name | bis(1H-imidazol-3-ium);phthalate |
| PubChem CID | 67313532 |
| Molecular Formula | C14H14N4O4 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | bis(1H-imidazol-3-ium);phthalate |
| SMILES | O=C([O-])c1ccccc1C(=O)[O-].c1c[nH+]c[nH]1.c1c[nH+]c[nH]1 |
| InChI | InChI=1S/C8H6O4.2C3H4N2/c9-7(10)5-3-1-2-4-6(5)8(11)12;2*1-2-5-3-4-1/h1-4H,(H,9,10)(H,11,12);2*1-3H,(H,4,5) |
| InChIKey | KXTSPQCZQYDUGX-UHFFFAOYSA-N |
| XLogP | -1.93 |
| TPSA | 140.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(1H-imidazol-3-ium);phthalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1H-imidazol-3-ium);phthalate?
The IUPAC name of bis(1H-imidazol-3-ium);phthalate (CID 67313532) is bis(1H-imidazol-3-ium);phthalate.
What is the SMILES notation for bis(1H-imidazol-3-ium);phthalate?
The canonical SMILES for bis(1H-imidazol-3-ium);phthalate is O=C([O-])c1ccccc1C(=O)[O-].c1c[nH+]c[nH]1.c1c[nH+]c[nH]1.
What is the InChIKey of bis(1H-imidazol-3-ium);phthalate?
The InChIKey is KXTSPQCZQYDUGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O4.2C3H4N2/c9-7(10)5-3-1-2-4-6(5)8(11)12;2*1-2-5-3-4-1/h1-4H,(H,9,10)(H,11,12);2*1-3H,(H,4,5).
What are the key properties of bis(1H-imidazol-3-ium);phthalate?
bis(1H-imidazol-3-ium);phthalate has a molecular weight of 302.29 g/mol, XLogP of -1.93, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1H-imidazol-3-ium);phthalate is sourced from PubChem (CID 67313532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).